C11H10N4O2S — CID 104742045
3-amino-N-(3-carbamoylthiophen-2-yl)pyridine-2-carboxamide (PubChem CID 104742045) has the molecular formula C11H10N4O2S and a molecular weight of 262.29 g/mol. Its IUPAC name is 3-amino-N-(3-carbamoylthiophen-2-yl)pyridine-2-carboxamide.
| Compound Name | 3-amino-N-(3-carbamoylthiophen-2-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 104742045 |
| Molecular Formula | C11H10N4O2S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 3-amino-N-(3-carbamoylthiophen-2-yl)pyridine-2-carboxamide |
| SMILES | NC(=O)c1ccsc1NC(=O)c1ncccc1N |
| InChI | InChI=1S/C11H10N4O2S/c12-7-2-1-4-14-8(7)10(17)15-11-6(9(13)16)3-5-18-11/h1-5H,12H2,(H2,13,16)(H,15,17) |
| InChIKey | XTBPLNQILMEGIR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |