C17H15ClN2O2 — CID 51295099
3-[[2-(2-chlorophenyl)cyclopropanecarbonyl]amino]benzamide (PubChem CID 51295099) has the molecular formula C17H15ClN2O2 and a molecular weight of 314.77 g/mol. Its IUPAC name is 3-[[2-(2-chlorophenyl)cyclopropanecarbonyl]amino]benzamide.
| Compound Name | 3-[[2-(2-chlorophenyl)cyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 51295099 |
| Molecular Formula | C17H15ClN2O2 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 3-[[2-(2-chlorophenyl)cyclopropanecarbonyl]amino]benzamide |
| SMILES | NC(=O)c1cccc(NC(=O)C2CC2c2ccccc2Cl)c1 |
| InChI | InChI=1S/C17H15ClN2O2/c18-15-7-2-1-6-12(15)13-9-14(13)17(22)20-11-5-3-4-10(8-11)16(19)21/h1-8,13-14H,9H2,(H2,19,21)(H,20,22) |
| InChIKey | DRHQJXWMPZWWOR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |