C17H14Cl2N2O2 — CID 95311713
2-chloro-4-[[(1R,2R)-2-(2-chlorophenyl)cyclopropanecarbonyl]amino]benzamide (PubChem CID 95311713) has the molecular formula C17H14Cl2N2O2 and a molecular weight of 349.22 g/mol. Its IUPAC name is 2-chloro-4-[[(1R,2R)-2-(2-chlorophenyl)cyclopropanecarbonyl]amino]benzamide.
| Compound Name | 2-chloro-4-[[(1R,2R)-2-(2-chlorophenyl)cyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 95311713 |
| Molecular Formula | C17H14Cl2N2O2 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 2-chloro-4-[[(1R,2R)-2-(2-chlorophenyl)cyclopropanecarbonyl]amino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)[C@@H]2C[C@H]2c2ccccc2Cl)cc1Cl |
| InChI | InChI=1S/C17H14Cl2N2O2/c18-14-4-2-1-3-10(14)12-8-13(12)17(23)21-9-5-6-11(16(20)22)15(19)7-9/h1-7,12-13H,8H2,(H2,20,22)(H,21,23)/t12-,13+/m0/s1 |
| InChIKey | ZQJVVJSXIITNCO-QWHCGFSZSA-N |
| XLogP | 3.83 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |