C21H19ClN2O3 — CID 78848282
2-(2-chlorophenyl)-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]cyclopropane-1-carboxamide (PubChem CID 78848282) has the molecular formula C21H19ClN2O3 and a molecular weight of 382.85 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]cyclopropane-1-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 78848282 |
| Molecular Formula | C21H19ClN2O3 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccc(CN2C(=O)CCC2=O)cc1)C1CC1c1ccccc1Cl |
| InChI | InChI=1S/C21H19ClN2O3/c22-18-4-2-1-3-15(18)16-11-17(16)21(27)23-14-7-5-13(6-8-14)12-24-19(25)9-10-20(24)26/h1-8,16-17H,9-12H2,(H,23,27) |
| InChIKey | YSDOCSGOIOAWML-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|