C14H17ClN2O2 — CID 95594248
trans-(1R,2R)-N-(4-amino-4-oxobutyl)-2-(2-chlorophenyl)cyclopropane-1-carboxamide (PubChem CID 95594248) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.76 g/mol. Its IUPAC name is trans-(1R,2R)-N-(4-amino-4-oxobutyl)-2-(2-chlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-(4-amino-4-oxobutyl)-2-(2-chlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 95594248 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | trans-(1R,2R)-N-(4-amino-4-oxobutyl)-2-(2-chlorophenyl)cyclopropane-1-carboxamide |
| SMILES | NC(=O)CCCNC(=O)[C@@H]1C[C@H]1c1ccccc1Cl |
| InChI | InChI=1S/C14H17ClN2O2/c15-12-5-2-1-4-9(12)10-8-11(10)14(19)17-7-3-6-13(16)18/h1-2,4-5,10-11H,3,6-8H2,(H2,16,18)(H,17,19)/t10-,11+/m0/s1 |
| InChIKey | FCYKKFNUGICMLY-WDEREUQCSA-N |
| XLogP | 1.83 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|