C17H29N3O2S — CID 111627218
1-ethyl-3-[2-(4-methoxyphenoxy)ethyl]-2-(4-methylsulfanylbutyl)guanidine (PubChem CID 111627218) has the molecular formula C17H29N3O2S and a molecular weight of 339.50 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-methoxyphenoxy)ethyl]-2-(4-methylsulfanylbutyl)guanidine.
| Compound Name | 1-ethyl-3-[2-(4-methoxyphenoxy)ethyl]-2-(4-methylsulfanylbutyl)guanidine |
|---|---|
| PubChem CID | 111627218 |
| Molecular Formula | C17H29N3O2S |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 1-ethyl-3-[2-(4-methoxyphenoxy)ethyl]-2-(4-methylsulfanylbutyl)guanidine |
| SMILES | CCN/C(=N\CCCCSC)NCCOc1ccc(OC)cc1 |
| InChI | InChI=1S/C17H29N3O2S/c1-4-18-17(19-11-5-6-14-23-3)20-12-13-22-16-9-7-15(21-2)8-10-16/h7-10H,4-6,11-14H2,1-3H3,(H2,18,19,20) |
| InChIKey | GZAZEITWBCKARF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|