C16H28IN5O3 — CID 111252170
methyl 1-[N-ethyl-N'-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111252170) has the molecular formula C16H28IN5O3 and a molecular weight of 465.34 g/mol. Its IUPAC name is methyl 1-[N-ethyl-N'-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N-ethyl-N'-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111252170 |
| Molecular Formula | C16H28IN5O3 |
| Molecular Weight | 465.34 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | methyl 1-[N-ethyl-N'-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCCc1nc(C)no1)N1CCC(C(=O)OC)CC1.I |
| InChI | InChI=1S/C16H27N5O3.HI/c1-4-17-16(18-9-5-6-14-19-12(2)20-24-14)21-10-7-13(8-11-21)15(22)23-3;/h13H,4-11H2,1-3H3,(H,17,18);1H |
| InChIKey | NAEURLQEDSSFCZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 92.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|