C18H33N5O — CID 111744067
N-ethyl-N'-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-3-pentan-3-ylpyrrolidine-1-carboximidamide (PubChem CID 111744067) has the molecular formula C18H33N5O and a molecular weight of 335.50 g/mol. Its IUPAC name is N-ethyl-N'-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-3-pentan-3-ylpyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-3-pentan-3-ylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111744067 |
| Molecular Formula | C18H33N5O |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.27 |
| IUPAC Name | N-ethyl-N'-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]-3-pentan-3-ylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCc1nc(C)no1)N1CCC(C(CC)CC)C1 |
| InChI | InChI=1S/C18H33N5O/c1-5-15(6-2)16-10-12-23(13-16)18(19-7-3)20-11-8-9-17-21-14(4)22-24-17/h15-16H,5-13H2,1-4H3,(H,19,20) |
| InChIKey | DHQCAKUIYZDEAM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 66.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|