C16H33N3O2S — CID 111743785
N-ethyl-N'-(2-ethylsulfonylethyl)-3-pentan-3-ylpyrrolidine-1-carboximidamide (PubChem CID 111743785) has the molecular formula C16H33N3O2S and a molecular weight of 331.53 g/mol. Its IUPAC name is N-ethyl-N'-(2-ethylsulfonylethyl)-3-pentan-3-ylpyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-(2-ethylsulfonylethyl)-3-pentan-3-ylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111743785 |
| Molecular Formula | C16H33N3O2S |
| Molecular Weight | 331.53 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | N-ethyl-N'-(2-ethylsulfonylethyl)-3-pentan-3-ylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCS(=O)(=O)CC)N1CCC(C(CC)CC)C1 |
| InChI | InChI=1S/C16H33N3O2S/c1-5-14(6-2)15-9-11-19(13-15)16(17-7-3)18-10-12-22(20,21)8-4/h14-15H,5-13H2,1-4H3,(H,17,18) |
| InChIKey | JWGBFSHGEJKOFQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.53 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|