C21H36N4O2S — CID 111744015
N-ethyl-N'-[[4-(methylsulfamoylmethyl)phenyl]methyl]-3-pentan-3-ylpyrrolidine-1-carboximidamide (PubChem CID 111744015) has the molecular formula C21H36N4O2S and a molecular weight of 408.61 g/mol. Its IUPAC name is N-ethyl-N'-[[4-(methylsulfamoylmethyl)phenyl]methyl]-3-pentan-3-ylpyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[[4-(methylsulfamoylmethyl)phenyl]methyl]-3-pentan-3-ylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111744015 |
| Molecular Formula | C21H36N4O2S |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | N-ethyl-N'-[[4-(methylsulfamoylmethyl)phenyl]methyl]-3-pentan-3-ylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(CS(=O)(=O)NC)cc1)N1CCC(C(CC)CC)C1 |
| InChI | InChI=1S/C21H36N4O2S/c1-5-19(6-2)20-12-13-25(15-20)21(23-7-3)24-14-17-8-10-18(11-9-17)16-28(26,27)22-4/h8-11,19-20,22H,5-7,12-16H2,1-4H3,(H,23,24) |
| InChIKey | SENHCNYMRVRHEU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|