C15H31N3O2S — CID 111743887
N-ethyl-N'-(2-methylsulfonylethyl)-3-pentan-3-ylpyrrolidine-1-carboximidamide (PubChem CID 111743887) has the molecular formula C15H31N3O2S and a molecular weight of 317.50 g/mol. Its IUPAC name is N-ethyl-N'-(2-methylsulfonylethyl)-3-pentan-3-ylpyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-(2-methylsulfonylethyl)-3-pentan-3-ylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111743887 |
| Molecular Formula | C15H31N3O2S |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | N-ethyl-N'-(2-methylsulfonylethyl)-3-pentan-3-ylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCS(C)(=O)=O)N1CCC(C(CC)CC)C1 |
| InChI | InChI=1S/C15H31N3O2S/c1-5-13(6-2)14-8-10-18(12-14)15(16-7-3)17-9-11-21(4,19)20/h13-14H,5-12H2,1-4H3,(H,16,17) |
| InChIKey | MYCSCWNIKWCHFY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|