C20H33N3O2S — CID 111743975
N-ethyl-N'-[(4-methylsulfonylphenyl)methyl]-3-pentan-3-ylpyrrolidine-1-carboximidamide (PubChem CID 111743975) has the molecular formula C20H33N3O2S and a molecular weight of 379.57 g/mol. Its IUPAC name is N-ethyl-N'-[(4-methylsulfonylphenyl)methyl]-3-pentan-3-ylpyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[(4-methylsulfonylphenyl)methyl]-3-pentan-3-ylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111743975 |
| Molecular Formula | C20H33N3O2S |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | N-ethyl-N'-[(4-methylsulfonylphenyl)methyl]-3-pentan-3-ylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(S(C)(=O)=O)cc1)N1CCC(C(CC)CC)C1 |
| InChI | InChI=1S/C20H33N3O2S/c1-5-17(6-2)18-12-13-23(15-18)20(21-7-3)22-14-16-8-10-19(11-9-16)26(4,24)25/h8-11,17-18H,5-7,12-15H2,1-4H3,(H,21,22) |
| InChIKey | DOWAZEATEVKNMP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|