C24H32N4O2S — CID 109414361
4-benzylidene-N-ethyl-N'-[[4-(methylsulfamoylmethyl)phenyl]methyl]piperidine-1-carboximidamide (PubChem CID 109414361) has the molecular formula C24H32N4O2S and a molecular weight of 440.61 g/mol. Its IUPAC name is 4-benzylidene-N-ethyl-N'-[[4-(methylsulfamoylmethyl)phenyl]methyl]piperidine-1-carboximidamide.
| Compound Name | 4-benzylidene-N-ethyl-N'-[[4-(methylsulfamoylmethyl)phenyl]methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109414361 |
| Molecular Formula | C24H32N4O2S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 4-benzylidene-N-ethyl-N'-[[4-(methylsulfamoylmethyl)phenyl]methyl]piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(CS(=O)(=O)NC)cc1)N1CCC(=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H32N4O2S/c1-3-26-24(27-18-22-9-11-23(12-10-22)19-31(29,30)25-2)28-15-13-21(14-16-28)17-20-7-5-4-6-8-20/h4-12,17,25H,3,13-16,18-19H2,1-2H3,(H,26,27) |
| InChIKey | SUCAWUWBALLLJZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|