C22H37N5O3 — CID 111303001
4-[(2,5-dimethoxyphenyl)methyl]-N-ethyl-N'-[(4-methylmorpholin-2-yl)methyl]piperazine-1-carboximidamide (PubChem CID 111303001) has the molecular formula C22H37N5O3 and a molecular weight of 419.57 g/mol. Its IUPAC name is 4-[(2,5-dimethoxyphenyl)methyl]-N-ethyl-N'-[(4-methylmorpholin-2-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-[(2,5-dimethoxyphenyl)methyl]-N-ethyl-N'-[(4-methylmorpholin-2-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111303001 |
| Molecular Formula | C22H37N5O3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.29 |
| IUPAC Name | 4-[(2,5-dimethoxyphenyl)methyl]-N-ethyl-N'-[(4-methylmorpholin-2-yl)methyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1CN(C)CCO1)N1CCN(Cc2cc(OC)ccc2OC)CC1 |
| InChI | InChI=1S/C22H37N5O3/c1-5-23-22(24-15-20-17-25(2)12-13-30-20)27-10-8-26(9-11-27)16-18-14-19(28-3)6-7-21(18)29-4/h6-7,14,20H,5,8-13,15-17H2,1-4H3,(H,23,24) |
| InChIKey | WLCRUIGIMIVQOJ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|