C24H34N4O4 — CID 111303507
4-[(2,5-dimethoxyphenyl)methyl]-N-ethyl-N'-[(2-hydroxy-3-methoxyphenyl)methyl]piperazine-1-carboximidamide (PubChem CID 111303507) has the molecular formula C24H34N4O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is 4-[(2,5-dimethoxyphenyl)methyl]-N-ethyl-N'-[(2-hydroxy-3-methoxyphenyl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-[(2,5-dimethoxyphenyl)methyl]-N-ethyl-N'-[(2-hydroxy-3-methoxyphenyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111303507 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 4-[(2,5-dimethoxyphenyl)methyl]-N-ethyl-N'-[(2-hydroxy-3-methoxyphenyl)methyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cccc(OC)c1O)N1CCN(Cc2cc(OC)ccc2OC)CC1 |
| InChI | InChI=1S/C24H34N4O4/c1-5-25-24(26-16-18-7-6-8-22(32-4)23(18)29)28-13-11-27(12-14-28)17-19-15-20(30-2)9-10-21(19)31-3/h6-10,15,29H,5,11-14,16-17H2,1-4H3,(H,25,26) |
| InChIKey | PGPYZWPCFGMGCK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|