C21H34N4O4 — CID 111303317
methyl 3-[[[4-[(2,5-dimethoxyphenyl)methyl]piperazin-1-yl]-(ethylamino)methylidene]amino]-2-methylpropanoate (PubChem CID 111303317) has the molecular formula C21H34N4O4 and a molecular weight of 406.53 g/mol. Its IUPAC name is methyl 3-[[[4-[(2,5-dimethoxyphenyl)methyl]piperazin-1-yl]-(ethylamino)methylidene]amino]-2-methylpropanoate.
| Compound Name | methyl 3-[[[4-[(2,5-dimethoxyphenyl)methyl]piperazin-1-yl]-(ethylamino)methylidene]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 111303317 |
| Molecular Formula | C21H34N4O4 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | methyl 3-[[[4-[(2,5-dimethoxyphenyl)methyl]piperazin-1-yl]-(ethylamino)methylidene]amino]-2-methylpropanoate |
| SMILES | CCN/C(=N\CC(C)C(=O)OC)N1CCN(Cc2cc(OC)ccc2OC)CC1 |
| InChI | InChI=1S/C21H34N4O4/c1-6-22-21(23-14-16(2)20(26)29-5)25-11-9-24(10-12-25)15-17-13-18(27-3)7-8-19(17)28-4/h7-8,13,16H,6,9-12,14-15H2,1-5H3,(H,22,23) |
| InChIKey | SHPIMIKWUBTRLD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|