C20H29N7OS — CID 110044163
2-[[N-benzyl-C-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]carbonimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 110044163) has the molecular formula C20H29N7OS and a molecular weight of 415.57 g/mol. Its IUPAC name is 2-[[N-benzyl-C-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]carbonimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N-benzyl-C-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]carbonimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110044163 |
| Molecular Formula | C20H29N7OS |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | 2-[[N-benzyl-C-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]carbonimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | CCc1nsc(N2CCN(/C(=N/Cc3ccccc3)NCC(=O)N(C)C)CC2)n1 |
| InChI | InChI=1S/C20H29N7OS/c1-4-17-23-20(29-24-17)27-12-10-26(11-13-27)19(22-15-18(28)25(2)3)21-14-16-8-6-5-7-9-16/h5-9H,4,10-15H2,1-3H3,(H,21,22) |
| InChIKey | VMWYLJQVAQQDIG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|