C24H33N5O2 — CID 110038575
2-[[N-[(4-methoxyphenyl)methyl]-C-[4-(3-methylphenyl)piperazin-1-yl]carbonimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 110038575) has the molecular formula C24H33N5O2 and a molecular weight of 423.56 g/mol. Its IUPAC name is 2-[[N-[(4-methoxyphenyl)methyl]-C-[4-(3-methylphenyl)piperazin-1-yl]carbonimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N-[(4-methoxyphenyl)methyl]-C-[4-(3-methylphenyl)piperazin-1-yl]carbonimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110038575 |
| Molecular Formula | C24H33N5O2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | 2-[[N-[(4-methoxyphenyl)methyl]-C-[4-(3-methylphenyl)piperazin-1-yl]carbonimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | COc1ccc(C/N=C(\NCC(=O)N(C)C)N2CCN(c3cccc(C)c3)CC2)cc1 |
| InChI | InChI=1S/C24H33N5O2/c1-19-6-5-7-21(16-19)28-12-14-29(15-13-28)24(26-18-23(30)27(2)3)25-17-20-8-10-22(31-4)11-9-20/h5-11,16H,12-15,17-18H2,1-4H3,(H,25,26) |
| InChIKey | FFGJZQXDJVLMAG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|