C21H30N6O3 — CID 110044229
2-[[N-[(4-methoxyphenyl)methyl]-C-[2-(1-methylpyrazol-4-yl)morpholin-4-yl]carbonimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 110044229) has the molecular formula C21H30N6O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-[[N-[(4-methoxyphenyl)methyl]-C-[2-(1-methylpyrazol-4-yl)morpholin-4-yl]carbonimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N-[(4-methoxyphenyl)methyl]-C-[2-(1-methylpyrazol-4-yl)morpholin-4-yl]carbonimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110044229 |
| Molecular Formula | C21H30N6O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 2-[[N-[(4-methoxyphenyl)methyl]-C-[2-(1-methylpyrazol-4-yl)morpholin-4-yl]carbonimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | COc1ccc(C/N=C(\NCC(=O)N(C)C)N2CCOC(c3cnn(C)c3)C2)cc1 |
| InChI | InChI=1S/C21H30N6O3/c1-25(2)20(28)13-23-21(22-11-16-5-7-18(29-4)8-6-16)27-9-10-30-19(15-27)17-12-24-26(3)14-17/h5-8,12,14,19H,9-11,13,15H2,1-4H3,(H,22,23) |
| InChIKey | UPLORQODQWMVBI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|