C18H30N6O2 — CID 110044203
2-[[(cyclopentylamino)-[2-(1-methylpyrazol-4-yl)morpholin-4-yl]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110044203) has the molecular formula C18H30N6O2 and a molecular weight of 362.48 g/mol. Its IUPAC name is 2-[[(cyclopentylamino)-[2-(1-methylpyrazol-4-yl)morpholin-4-yl]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(cyclopentylamino)-[2-(1-methylpyrazol-4-yl)morpholin-4-yl]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110044203 |
| Molecular Formula | C18H30N6O2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 2-[[(cyclopentylamino)-[2-(1-methylpyrazol-4-yl)morpholin-4-yl]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(/NC1CCCC1)N1CCOC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C18H30N6O2/c1-22(2)17(25)11-19-18(21-15-6-4-5-7-15)24-8-9-26-16(13-24)14-10-20-23(3)12-14/h10,12,15-16H,4-9,11,13H2,1-3H3,(H,19,21) |
| InChIKey | PKARWFNWHWWUAR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 74.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|