C19H29N3O2 — CID 86769751
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-[2-(1-methylpyrazol-4-yl)morpholin-4-yl]methanone (PubChem CID 86769751) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-[2-(1-methylpyrazol-4-yl)morpholin-4-yl]methanone.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-[2-(1-methylpyrazol-4-yl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 86769751 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-[2-(1-methylpyrazol-4-yl)morpholin-4-yl]methanone |
| SMILES | Cn1cc(C2CN(C(=O)C3CCC4CCCCC4C3)CCO2)cn1 |
| InChI | InChI=1S/C19H29N3O2/c1-21-12-17(11-20-21)18-13-22(8-9-24-18)19(23)16-7-6-14-4-2-3-5-15(14)10-16/h11-12,14-16,18H,2-10,13H2,1H3 |
| InChIKey | DNPDESWSIOTWMU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |