C22H31FIN5OS — CID 110048077
2-[[[4-[(3-fluorophenyl)methyl]piperazin-1-yl]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110048077) has the molecular formula C22H31FIN5OS and a molecular weight of 559.49 g/mol. Its IUPAC name is 2-[[[4-[(3-fluorophenyl)methyl]piperazin-1-yl]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[4-[(3-fluorophenyl)methyl]piperazin-1-yl]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110048077 |
| Molecular Formula | C22H31FIN5OS |
| Molecular Weight | 559.49 g/mol |
| Exact Mass | 559.13 |
| IUPAC Name | 2-[[[4-[(3-fluorophenyl)methyl]piperazin-1-yl]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCCc1cccs1)N1CCN(Cc2cccc(F)c2)CC1.I |
| InChI | InChI=1S/C22H30FN5OS.HI/c1-26(2)21(29)16-25-22(24-9-8-20-7-4-14-30-20)28-12-10-27(11-13-28)17-18-5-3-6-19(23)15-18;/h3-7,14-15H,8-13,16-17H2,1-2H3,(H,24,25);1H |
| InChIKey | LCGRFTPHGWYBIB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|