C20H24F2N4OS — CID 110048248
2-[[(5,7-difluoro-3,4-dihydro-1H-isoquinolin-2-yl)-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110048248) has the molecular formula C20H24F2N4OS and a molecular weight of 406.50 g/mol. Its IUPAC name is 2-[[(5,7-difluoro-3,4-dihydro-1H-isoquinolin-2-yl)-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(5,7-difluoro-3,4-dihydro-1H-isoquinolin-2-yl)-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110048248 |
| Molecular Formula | C20H24F2N4OS |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 2-[[(5,7-difluoro-3,4-dihydro-1H-isoquinolin-2-yl)-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCCc1cccs1)N1CCc2c(F)cc(F)cc2C1 |
| InChI | InChI=1S/C20H24F2N4OS/c1-25(2)19(27)12-24-20(23-7-5-16-4-3-9-28-16)26-8-6-17-14(13-26)10-15(21)11-18(17)22/h3-4,9-11H,5-8,12-13H2,1-2H3,(H,23,24) |
| InChIKey | YSGGBUPDWRCCQJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|