C18H26F2N4O — CID 110048222
2-[[(5,7-difluoro-3,4-dihydro-1H-isoquinolin-2-yl)-(2-methylpropylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110048222) has the molecular formula C18H26F2N4O and a molecular weight of 352.43 g/mol. Its IUPAC name is 2-[[(5,7-difluoro-3,4-dihydro-1H-isoquinolin-2-yl)-(2-methylpropylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(5,7-difluoro-3,4-dihydro-1H-isoquinolin-2-yl)-(2-methylpropylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110048222 |
| Molecular Formula | C18H26F2N4O |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | 2-[[(5,7-difluoro-3,4-dihydro-1H-isoquinolin-2-yl)-(2-methylpropylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CC(C)CN/C(=N\CC(=O)N(C)C)N1CCc2c(F)cc(F)cc2C1 |
| InChI | InChI=1S/C18H26F2N4O/c1-12(2)9-21-18(22-10-17(25)23(3)4)24-6-5-15-13(11-24)7-14(19)8-16(15)20/h7-8,12H,5-6,9-11H2,1-4H3,(H,21,22) |
| InChIKey | DVYZANXQNAVPSE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|