C18H27ClN6OS — CID 111702076
1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111702076) has the molecular formula C18H27ClN6OS and a molecular weight of 410.98 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111702076 |
| Molecular Formula | C18H27ClN6OS |
| Molecular Weight | 410.98 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | Cc1nnc(C/N=C(\NCC(O)c2ccc(Cl)s2)NC2CCCCC2)n1C |
| InChI | InChI=1S/C18H27ClN6OS/c1-12-23-24-17(25(12)2)11-21-18(22-13-6-4-3-5-7-13)20-10-14(26)15-8-9-16(19)27-15/h8-9,13-14,26H,3-7,10-11H2,1-2H3,(H2,20,21,22) |
| InChIKey | ZZEAYMVKSRZAIY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.98 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|