C14H23ClIN3OS — CID 119139318
1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-cyclohexyl-2-methylguanidine;hydroiodide (PubChem CID 119139318) has the molecular formula C14H23ClIN3OS and a molecular weight of 443.78 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-cyclohexyl-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-cyclohexyl-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119139318 |
| Molecular Formula | C14H23ClIN3OS |
| Molecular Weight | 443.78 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-cyclohexyl-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC(O)c1ccc(Cl)s1)NC1CCCCC1.I |
| InChI | InChI=1S/C14H22ClN3OS.HI/c1-16-14(18-10-5-3-2-4-6-10)17-9-11(19)12-7-8-13(15)20-12;/h7-8,10-11,19H,2-6,9H2,1H3,(H2,16,17,18);1H |
| InChIKey | BZKFAUGLSLPESO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.78 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|