C11H18ClIN4O2S — CID 119142109
2-[[N-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N'-methylcarbamimidoyl]amino]-N-methylacetamide;hydroiodide (PubChem CID 119142109) has the molecular formula C11H18ClIN4O2S and a molecular weight of 432.72 g/mol. Its IUPAC name is 2-[[N-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N'-methylcarbamimidoyl]amino]-N-methylacetamide;hydroiodide.
| Compound Name | 2-[[N-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N'-methylcarbamimidoyl]amino]-N-methylacetamide;hydroiodide |
|---|---|
| PubChem CID | 119142109 |
| Molecular Formula | C11H18ClIN4O2S |
| Molecular Weight | 432.72 g/mol |
| Exact Mass | 431.99 |
| IUPAC Name | 2-[[N-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N'-methylcarbamimidoyl]amino]-N-methylacetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)NC)NCC(O)c1ccc(Cl)s1.I |
| InChI | InChI=1S/C11H17ClN4O2S.HI/c1-13-10(18)6-16-11(14-2)15-5-7(17)8-3-4-9(12)19-8;/h3-4,7,17H,5-6H2,1-2H3,(H,13,18)(H2,14,15,16);1H |
| InChIKey | CFMNLNOMVNJBBQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.72 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|