C13H20ClN3O3S — CID 119142120
1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-(1,4-dioxan-2-ylmethyl)-2-methylguanidine (PubChem CID 119142120) has the molecular formula C13H20ClN3O3S and a molecular weight of 333.84 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-(1,4-dioxan-2-ylmethyl)-2-methylguanidine.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-(1,4-dioxan-2-ylmethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 119142120 |
| Molecular Formula | C13H20ClN3O3S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-(1,4-dioxan-2-ylmethyl)-2-methylguanidine |
| SMILES | C/N=C(/NCC1COCCO1)NCC(O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H20ClN3O3S/c1-15-13(16-6-9-8-19-4-5-20-9)17-7-10(18)11-2-3-12(14)21-11/h2-3,9-10,18H,4-8H2,1H3,(H2,15,16,17) |
| InChIKey | QQPDUUVTJFPBCM-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|