C12H20IN3O3 — CID 119151246
1-(1,4-dioxan-2-ylmethyl)-3-(furan-3-ylmethyl)-2-methylguanidine;hydroiodide (PubChem CID 119151246) has the molecular formula C12H20IN3O3 and a molecular weight of 381.21 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-ylmethyl)-3-(furan-3-ylmethyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-(1,4-dioxan-2-ylmethyl)-3-(furan-3-ylmethyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119151246 |
| Molecular Formula | C12H20IN3O3 |
| Molecular Weight | 381.21 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 1-(1,4-dioxan-2-ylmethyl)-3-(furan-3-ylmethyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccoc1)NCC1COCCO1.I |
| InChI | InChI=1S/C12H19N3O3.HI/c1-13-12(14-6-10-2-3-16-8-10)15-7-11-9-17-4-5-18-11;/h2-3,8,11H,4-7,9H2,1H3,(H2,13,14,15);1H |
| InChIKey | GRJZGJVUTBDXGV-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|