C12H21ClIN3OS — CID 119139270
1-butan-2-yl-3-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-methylguanidine;hydroiodide (PubChem CID 119139270) has the molecular formula C12H21ClIN3OS and a molecular weight of 417.74 g/mol. Its IUPAC name is 1-butan-2-yl-3-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-butan-2-yl-3-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119139270 |
| Molecular Formula | C12H21ClIN3OS |
| Molecular Weight | 417.74 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | 1-butan-2-yl-3-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCC(C)N/C(=N\C)NCC(O)c1ccc(Cl)s1.I |
| InChI | InChI=1S/C12H20ClN3OS.HI/c1-4-8(2)16-12(14-3)15-7-9(17)10-5-6-11(13)18-10;/h5-6,8-9,17H,4,7H2,1-3H3,(H2,14,15,16);1H |
| InChIKey | QJETZTWCLFSRQC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.74 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|