C12H23IN6 — CID 119129801
1-cyclopropyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-propan-2-ylguanidine;hydroiodide (PubChem CID 119129801) has the molecular formula C12H23IN6 and a molecular weight of 378.26 g/mol. Its IUPAC name is 1-cyclopropyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-propan-2-ylguanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-propan-2-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119129801 |
| Molecular Formula | C12H23IN6 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 1-cyclopropyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-propan-2-ylguanidine;hydroiodide |
| SMILES | Cc1nnc(C/N=C(\NC(C)C)NC2CC2)n1C.I |
| InChI | InChI=1S/C12H22N6.HI/c1-8(2)14-12(15-10-5-6-10)13-7-11-17-16-9(3)18(11)4;/h8,10H,5-7H2,1-4H3,(H2,13,14,15);1H |
| InChIKey | APMVYLFBXHOVEZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|