C20H39IN6 — CID 111212866
1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-octan-2-ylguanidine;hydroiodide (PubChem CID 111212866) has the molecular formula C20H39IN6 and a molecular weight of 490.48 g/mol. Its IUPAC name is 1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-octan-2-ylguanidine;hydroiodide.
| Compound Name | 1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-octan-2-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111212866 |
| Molecular Formula | C20H39IN6 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-octan-2-ylguanidine;hydroiodide |
| SMILES | CCCCCCC(C)N/C(=N\Cc1nnc(C)n1C)NC1CCCCC1.I |
| InChI | InChI=1S/C20H38N6.HI/c1-5-6-7-9-12-16(2)22-20(23-18-13-10-8-11-14-18)21-15-19-25-24-17(3)26(19)4;/h16,18H,5-15H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | KXTFVKTZTTWSOZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|