C21H37N7S — CID 111860157
1-[5-(diethylamino)pentan-2-yl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111860157) has the molecular formula C21H37N7S and a molecular weight of 419.64 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111860157 |
| Molecular Formula | C21H37N7S |
| Molecular Weight | 419.64 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(2-thiophen-2-ylethyl)guanidine |
| SMILES | CCN(CC)CCCC(C)N/C(=N/Cc1nnc(C)n1C)NCCc1cccs1 |
| InChI | InChI=1S/C21H37N7S/c1-6-28(7-2)14-8-10-17(3)24-21(22-13-12-19-11-9-15-29-19)23-16-20-26-25-18(4)27(20)5/h9,11,15,17H,6-8,10,12-14,16H2,1-5H3,(H2,22,23,24) |
| InChIKey | SKRMBHNTHHJEEA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.64 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|