C20H37N5OS — CID 111860159
2-[[[5-(diethylamino)pentan-2-ylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111860159) has the molecular formula C20H37N5OS and a molecular weight of 395.62 g/mol. Its IUPAC name is 2-[[[5-(diethylamino)pentan-2-ylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[5-(diethylamino)pentan-2-ylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111860159 |
| Molecular Formula | C20H37N5OS |
| Molecular Weight | 395.62 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | 2-[[[5-(diethylamino)pentan-2-ylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCN(CC)CCCC(C)N/C(=N\CC(=O)N(C)C)NCCc1cccs1 |
| InChI | InChI=1S/C20H37N5OS/c1-6-25(7-2)14-8-10-17(3)23-20(22-16-19(26)24(4)5)21-13-12-18-11-9-15-27-18/h9,11,15,17H,6-8,10,12-14,16H2,1-5H3,(H2,21,22,23) |
| InChIKey | IQLHDYPYIXROKC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.62 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|