C17H35N5O — CID 110999511
2-[[[5-(diethylamino)pentan-2-ylamino]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110999511) has the molecular formula C17H35N5O and a molecular weight of 325.50 g/mol. Its IUPAC name is 2-[[[5-(diethylamino)pentan-2-ylamino]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[5-(diethylamino)pentan-2-ylamino]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110999511 |
| Molecular Formula | C17H35N5O |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.28 |
| IUPAC Name | 2-[[[5-(diethylamino)pentan-2-ylamino]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | C=CCN/C(=N\CC(=O)N(C)C)NC(C)CCCN(CC)CC |
| InChI | InChI=1S/C17H35N5O/c1-7-12-18-17(19-14-16(23)21(5)6)20-15(4)11-10-13-22(8-2)9-3/h7,15H,1,8-14H2,2-6H3,(H2,18,19,20) |
| InChIKey | TYGVRJLTOBVMAE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|