C23H35IN4O3S — CID 110037752
2-[[[1-(3,4-diethoxyphenyl)ethylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110037752) has the molecular formula C23H35IN4O3S and a molecular weight of 574.53 g/mol. Its IUPAC name is 2-[[[1-(3,4-diethoxyphenyl)ethylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[1-(3,4-diethoxyphenyl)ethylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110037752 |
| Molecular Formula | C23H35IN4O3S |
| Molecular Weight | 574.53 g/mol |
| Exact Mass | 574.15 |
| IUPAC Name | 2-[[[1-(3,4-diethoxyphenyl)ethylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCOc1ccc(C(C)N/C(=N/CC(=O)N(C)C)NCCc2cccs2)cc1OCC.I |
| InChI | InChI=1S/C23H34N4O3S.HI/c1-6-29-20-11-10-18(15-21(20)30-7-2)17(3)26-23(25-16-22(28)27(4)5)24-13-12-19-9-8-14-31-19;/h8-11,14-15,17H,6-7,12-13,16H2,1-5H3,(H2,24,25,26);1H |
| InChIKey | JDXZWSMACWFCSY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|