C22H33IN4O3S — CID 111297740
N-[3-[[N-[1-(3,4-diethoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide (PubChem CID 111297740) has the molecular formula C22H33IN4O3S and a molecular weight of 560.50 g/mol. Its IUPAC name is N-[3-[[N-[1-(3,4-diethoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[N-[1-(3,4-diethoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111297740 |
| Molecular Formula | C22H33IN4O3S |
| Molecular Weight | 560.50 g/mol |
| Exact Mass | 560.13 |
| IUPAC Name | N-[3-[[N-[1-(3,4-diethoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide |
| SMILES | CCOc1ccc(C(C)N/C(=N/C)NCCCNC(=O)c2cccs2)cc1OCC.I |
| InChI | InChI=1S/C22H32N4O3S.HI/c1-5-28-18-11-10-17(15-19(18)29-6-2)16(3)26-22(23-4)25-13-8-12-24-21(27)20-9-7-14-30-20;/h7,9-11,14-16H,5-6,8,12-13H2,1-4H3,(H,24,27)(H2,23,25,26);1H |
| InChIKey | LPLAKUYDNIGNRH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|