C23H33N3O4S — CID 111298307
1-[3-(benzenesulfonyl)propyl]-3-[1-(3,4-diethoxyphenyl)ethyl]-2-methylguanidine (PubChem CID 111298307) has the molecular formula C23H33N3O4S and a molecular weight of 447.60 g/mol. Its IUPAC name is 1-[3-(benzenesulfonyl)propyl]-3-[1-(3,4-diethoxyphenyl)ethyl]-2-methylguanidine.
| Compound Name | 1-[3-(benzenesulfonyl)propyl]-3-[1-(3,4-diethoxyphenyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111298307 |
| Molecular Formula | C23H33N3O4S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 1-[3-(benzenesulfonyl)propyl]-3-[1-(3,4-diethoxyphenyl)ethyl]-2-methylguanidine |
| SMILES | CCOc1ccc(C(C)N/C(=N/C)NCCCS(=O)(=O)c2ccccc2)cc1OCC |
| InChI | InChI=1S/C23H33N3O4S/c1-5-29-21-14-13-19(17-22(21)30-6-2)18(3)26-23(24-4)25-15-10-16-31(27,28)20-11-8-7-9-12-20/h7-9,11-14,17-18H,5-6,10,15-16H2,1-4H3,(H2,24,25,26) |
| InChIKey | JLARZQPOGNXKIE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|