C22H35IN4O2S — CID 111298476
1-[1-(3,4-diethoxyphenyl)ethyl]-2-methyl-3-[4-(4-methyl-1,3-thiazol-2-yl)butyl]guanidine;hydroiodide (PubChem CID 111298476) has the molecular formula C22H35IN4O2S and a molecular weight of 546.52 g/mol. Its IUPAC name is 1-[1-(3,4-diethoxyphenyl)ethyl]-2-methyl-3-[4-(4-methyl-1,3-thiazol-2-yl)butyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(3,4-diethoxyphenyl)ethyl]-2-methyl-3-[4-(4-methyl-1,3-thiazol-2-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111298476 |
| Molecular Formula | C22H35IN4O2S |
| Molecular Weight | 546.52 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | 1-[1-(3,4-diethoxyphenyl)ethyl]-2-methyl-3-[4-(4-methyl-1,3-thiazol-2-yl)butyl]guanidine;hydroiodide |
| SMILES | CCOc1ccc(C(C)N/C(=N/C)NCCCCc2nc(C)cs2)cc1OCC.I |
| InChI | InChI=1S/C22H34N4O2S.HI/c1-6-27-19-12-11-18(14-20(19)28-7-2)17(4)26-22(23-5)24-13-9-8-10-21-25-16(3)15-29-21;/h11-12,14-15,17H,6-10,13H2,1-5H3,(H2,23,24,26);1H |
| InChIKey | OQHOPGDAFJKEKP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|