C19H29IN4O2S — CID 111203025
1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-3-[4-(4-methyl-1,3-thiazol-2-yl)butyl]guanidine;hydroiodide (PubChem CID 111203025) has the molecular formula C19H29IN4O2S and a molecular weight of 504.44 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-3-[4-(4-methyl-1,3-thiazol-2-yl)butyl]guanidine;hydroiodide.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-3-[4-(4-methyl-1,3-thiazol-2-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111203025 |
| Molecular Formula | C19H29IN4O2S |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-3-[4-(4-methyl-1,3-thiazol-2-yl)butyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCCc1nc(C)cs1)NCc1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C19H28N4O2S.HI/c1-14-13-26-18(23-14)7-5-6-10-21-19(20-2)22-12-15-8-9-16(24-3)17(11-15)25-4;/h8-9,11,13H,5-7,10,12H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | LZAMYBMVTCLXMF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|