C20H31IN4O2S — CID 111215264
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-2-[3-(4-methyl-1,3-thiazol-2-yl)propyl]guanidine;hydroiodide (PubChem CID 111215264) has the molecular formula C20H31IN4O2S and a molecular weight of 518.47 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-2-[3-(4-methyl-1,3-thiazol-2-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-2-[3-(4-methyl-1,3-thiazol-2-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111215264 |
| Molecular Formula | C20H31IN4O2S |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-2-[3-(4-methyl-1,3-thiazol-2-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCc1nc(C)cs1)NCCc1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C20H30N4O2S.HI/c1-5-21-20(22-11-6-7-19-24-15(2)14-27-19)23-12-10-16-8-9-17(25-3)18(13-16)26-4;/h8-9,13-14H,5-7,10-12H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | YZZFOEITGRAOKG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|