C14H26N4OS — CID 110975999
1-(3-methoxypropyl)-2-methyl-3-[4-(4-methyl-1,3-thiazol-2-yl)butyl]guanidine (PubChem CID 110975999) has the molecular formula C14H26N4OS and a molecular weight of 298.46 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-2-methyl-3-[4-(4-methyl-1,3-thiazol-2-yl)butyl]guanidine.
| Compound Name | 1-(3-methoxypropyl)-2-methyl-3-[4-(4-methyl-1,3-thiazol-2-yl)butyl]guanidine |
|---|---|
| PubChem CID | 110975999 |
| Molecular Formula | C14H26N4OS |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 1-(3-methoxypropyl)-2-methyl-3-[4-(4-methyl-1,3-thiazol-2-yl)butyl]guanidine |
| SMILES | C/N=C(/NCCCCc1nc(C)cs1)NCCCOC |
| InChI | InChI=1S/C14H26N4OS/c1-12-11-20-13(18-12)7-4-5-8-16-14(15-2)17-9-6-10-19-3/h11H,4-10H2,1-3H3,(H2,15,16,17) |
| InChIKey | YKTALZPAHMRUBP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|