C18H26N4S2 — CID 111372973
2-methyl-1-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-3-(2-phenylsulfanylethyl)guanidine (PubChem CID 111372973) has the molecular formula C18H26N4S2 and a molecular weight of 362.57 g/mol. Its IUPAC name is 2-methyl-1-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-3-(2-phenylsulfanylethyl)guanidine.
| Compound Name | 2-methyl-1-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-3-(2-phenylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111372973 |
| Molecular Formula | C18H26N4S2 |
| Molecular Weight | 362.57 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2-methyl-1-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-3-(2-phenylsulfanylethyl)guanidine |
| SMILES | C/N=C(\NCCCCc1nc(C)cs1)NCCSc1ccccc1 |
| InChI | InChI=1S/C18H26N4S2/c1-15-14-24-17(22-15)10-6-7-11-20-18(19-2)21-12-13-23-16-8-4-3-5-9-16/h3-5,8-9,14H,6-7,10-13H2,1-2H3,(H2,19,20,21) |
| InChIKey | DADPODWFYLDJCB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|