C21H29IN4O — CID 111033221
2-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-1-(2-phenylethyl)guanidine;hydroiodide (PubChem CID 111033221) has the molecular formula C21H29IN4O and a molecular weight of 480.39 g/mol. Its IUPAC name is 2-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-1-(2-phenylethyl)guanidine;hydroiodide.
| Compound Name | 2-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-1-(2-phenylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111033221 |
| Molecular Formula | C21H29IN4O |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 2-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-1-(2-phenylethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccccc1CN1CCOCC1)NCCc1ccccc1 |
| InChI | InChI=1S/C21H28N4O.HI/c22-21(23-11-10-18-6-2-1-3-7-18)24-16-19-8-4-5-9-20(19)17-25-12-14-26-15-13-25;/h1-9H,10-17H2,(H3,22,23,24);1H |
| InChIKey | SQQGVNIMSFKPDR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|