C16H27IN4O2 — CID 111032233
2-(2-hydroxy-3-morpholin-4-ylpropyl)-1-(2-phenylethyl)guanidine;hydroiodide (PubChem CID 111032233) has the molecular formula C16H27IN4O2 and a molecular weight of 434.32 g/mol. Its IUPAC name is 2-(2-hydroxy-3-morpholin-4-ylpropyl)-1-(2-phenylethyl)guanidine;hydroiodide.
| Compound Name | 2-(2-hydroxy-3-morpholin-4-ylpropyl)-1-(2-phenylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111032233 |
| Molecular Formula | C16H27IN4O2 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 2-(2-hydroxy-3-morpholin-4-ylpropyl)-1-(2-phenylethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CC(O)CN1CCOCC1)NCCc1ccccc1 |
| InChI | InChI=1S/C16H26N4O2.HI/c17-16(18-7-6-14-4-2-1-3-5-14)19-12-15(21)13-20-8-10-22-11-9-20;/h1-5,15,21H,6-13H2,(H3,17,18,19);1H |
| InChIKey | ZXSZHAXLPKWTPB-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 83.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|