C15H25IN4O3 — CID 111032217
2-(2-hydroxy-3-morpholin-4-ylpropyl)-1-(3-methoxyphenyl)guanidine;hydroiodide (PubChem CID 111032217) has the molecular formula C15H25IN4O3 and a molecular weight of 436.29 g/mol. Its IUPAC name is 2-(2-hydroxy-3-morpholin-4-ylpropyl)-1-(3-methoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-(2-hydroxy-3-morpholin-4-ylpropyl)-1-(3-methoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111032217 |
| Molecular Formula | C15H25IN4O3 |
| Molecular Weight | 436.29 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 2-(2-hydroxy-3-morpholin-4-ylpropyl)-1-(3-methoxyphenyl)guanidine;hydroiodide |
| SMILES | COc1cccc(N/C(N)=N/CC(O)CN2CCOCC2)c1.I |
| InChI | InChI=1S/C15H24N4O3.HI/c1-21-14-4-2-3-12(9-14)18-15(16)17-10-13(20)11-19-5-7-22-8-6-19;/h2-4,9,13,20H,5-8,10-11H2,1H3,(H3,16,17,18);1H |
| InChIKey | UBWKAHJYGDHXKZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|