C19H25IN4O2 — CID 111063059
1-(3-methoxyphenyl)-2-[(4-morpholin-4-ylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111063059) has the molecular formula C19H25IN4O2 and a molecular weight of 468.34 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2-[(4-morpholin-4-ylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-methoxyphenyl)-2-[(4-morpholin-4-ylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111063059 |
| Molecular Formula | C19H25IN4O2 |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 1-(3-methoxyphenyl)-2-[(4-morpholin-4-ylphenyl)methyl]guanidine;hydroiodide |
| SMILES | COc1cccc(N/C(N)=N/Cc2ccc(N3CCOCC3)cc2)c1.I |
| InChI | InChI=1S/C19H24N4O2.HI/c1-24-18-4-2-3-16(13-18)22-19(20)21-14-15-5-7-17(8-6-15)23-9-11-25-12-10-23;/h2-8,13H,9-12,14H2,1H3,(H3,20,21,22);1H |
| InChIKey | POLPVCGUVLCENA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|