C16H17IN4O — CID 111052279
2-[(4-cyanophenyl)methyl]-1-(3-methoxyphenyl)guanidine;hydroiodide (PubChem CID 111052279) has the molecular formula C16H17IN4O and a molecular weight of 408.24 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)methyl]-1-(3-methoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[(4-cyanophenyl)methyl]-1-(3-methoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111052279 |
| Molecular Formula | C16H17IN4O |
| Molecular Weight | 408.24 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 2-[(4-cyanophenyl)methyl]-1-(3-methoxyphenyl)guanidine;hydroiodide |
| SMILES | COc1cccc(N/C(N)=N/Cc2ccc(C#N)cc2)c1.I |
| InChI | InChI=1S/C16H16N4O.HI/c1-21-15-4-2-3-14(9-15)20-16(18)19-11-13-7-5-12(10-17)6-8-13;/h2-9H,11H2,1H3,(H3,18,19,20);1H |
| InChIKey | RSGUXRMVDXDYPU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 83.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|