C18H29FIN5 — CID 110031138
1-cyclopropyl-2-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-1-methylguanidine;hydroiodide (PubChem CID 110031138) has the molecular formula C18H29FIN5 and a molecular weight of 461.37 g/mol. Its IUPAC name is 1-cyclopropyl-2-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-1-methylguanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-2-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110031138 |
| Molecular Formula | C18H29FIN5 |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 1-cyclopropyl-2-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-1-methylguanidine;hydroiodide |
| SMILES | CN(/C(N)=N/CCCN1CCN(c2ccccc2F)CC1)C1CC1.I |
| InChI | InChI=1S/C18H28FN5.HI/c1-22(15-7-8-15)18(20)21-9-4-10-23-11-13-24(14-12-23)17-6-3-2-5-16(17)19;/h2-3,5-6,15H,4,7-14H2,1H3,(H2,20,21);1H |
| InChIKey | YFZGCORNOPDKHN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 48.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|