C16H26FN3O — CID 64818951
1-amino-5-[4-(2-fluorophenyl)piperazin-1-yl]-2-methylpentan-2-ol (PubChem CID 64818951) has the molecular formula C16H26FN3O and a molecular weight of 295.40 g/mol. Its IUPAC name is 1-amino-5-[4-(2-fluorophenyl)piperazin-1-yl]-2-methylpentan-2-ol.
| Compound Name | 1-amino-5-[4-(2-fluorophenyl)piperazin-1-yl]-2-methylpentan-2-ol |
|---|---|
| PubChem CID | 64818951 |
| Molecular Formula | C16H26FN3O |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 1-amino-5-[4-(2-fluorophenyl)piperazin-1-yl]-2-methylpentan-2-ol |
| SMILES | CC(O)(CN)CCCN1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C16H26FN3O/c1-16(21,13-18)7-4-8-19-9-11-20(12-10-19)15-6-3-2-5-14(15)17/h2-3,5-6,21H,4,7-13,18H2,1H3 |
| InChIKey | CJYNOISBNZUOHD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |